CAS 129922-49-2 appears in our catalog under these names: 2-((Trifluoromethyl)sulfinyl)-1,1'-biphenyl, 98%, 2-((Trifluoromethyl)sulfinyl)-1,1'-biphenyl, 95+%, 2-((Trifluoromethyl)sulfinyl)-1,1'-biphenyl, 95+%, 95+%. Offered by: Fluorochem, Ambeed, Chemat. Available pack sizes: 1g, 100mg, 250mg.
1-phenyl-2-(trifluoromethylsulfinyl)benzene (CAS 129922-49-2) is a chemical compound with the molecular formula C13H9F3OS and a molecular weight of 270.27 g/mol. IUPAC name: 1-phenyl-2-(trifluoromethylsulfinyl)benzene. InChIKey: CLDLXLKMMYJIEK-UHFFFAOYSA-N.
| Molecular formula | C13H9F3OS |
|---|---|
| Molecular weight | 270.27 g/mol |
| IUPAC name | 1-phenyl-2-(trifluoromethylsulfinyl)benzene |
| InChIKey | CLDLXLKMMYJIEK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2S(=O)C(F)(F)F |
Computed by PubChem (NCBI)