CAS 1299607-54-7 is the registry number for 2,5-Dichloro-6-iodonicotinaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2,5-dichloro-6-iodopyridine-3-carbaldehyde (CAS 1299607-54-7) is a chemical compound with the molecular formula C6H2Cl2INO and a molecular weight of 301.89 g/mol. IUPAC name: 2,5-dichloro-6-iodopyridine-3-carbaldehyde. InChIKey: UWBIGQSFURXXAZ-UHFFFAOYSA-N.
| Molecular formula | C6H2Cl2INO |
|---|---|
| Molecular weight | 301.89 g/mol |
| IUPAC name | 2,5-dichloro-6-iodopyridine-3-carbaldehyde |
| InChIKey | UWBIGQSFURXXAZ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=C1Cl)I)Cl)C=O |
Computed by PubChem (NCBI)