CAS 1299607-63-8 is the registry number for 5-Fluoro-3-iodo-2-pivalamidoisonicotinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(2,2-dimethylpropanoylamino)-5-fluoro-3-iodopyridine-4-carboxylic acid (CAS 1299607-63-8) is a chemical compound with the molecular formula C11H12FIN2O3 and a molecular weight of 366.13 g/mol. IUPAC name: 2-(2,2-dimethylpropanoylamino)-5-fluoro-3-iodopyridine-4-carboxylic acid. InChIKey: QGVJWXDJUNTHLP-UHFFFAOYSA-N.
| Molecular formula | C11H12FIN2O3 |
|---|---|
| Molecular weight | 366.13 g/mol |
| IUPAC name | 2-(2,2-dimethylpropanoylamino)-5-fluoro-3-iodopyridine-4-carboxylic acid |
| InChIKey | QGVJWXDJUNTHLP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=NC=C(C(=C1I)C(=O)O)F |
Computed by PubChem (NCBI)