CAS 1300-37-4 is the registry number for Bariumphenolsulfonate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Barium(2+);bis(2-hydroxybenzenesulfonate) (CAS 1300-37-4) is a chemical compound with the molecular formula C12H10BaO8S2 and a molecular weight of 483.7 g/mol. IUPAC name: barium(2+);bis(2-hydroxybenzenesulfonate). InChIKey: SAMQGYDWPDZOHP-UHFFFAOYSA-L.
| Molecular formula | C12H10BaO8S2 |
|---|---|
| Molecular weight | 483.7 g/mol |
| IUPAC name | barium(2+);bis(2-hydroxybenzenesulfonate) |
| InChIKey | SAMQGYDWPDZOHP-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C(=C1)O)S(=O)(=O)[O-].C1=CC=C(C(=C1)O)S(=O)(=O)[O-].[Ba+2] |
Computed by PubChem (NCBI)