CAS 130048-57-6 appears in our catalog under these names: Octadecanoic-9,9,10,10-d4 Acid, 99 atom % D, min 98% Chemical Purity, Stearic Acid–d4, Stearic acid-d4, 99.80%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 10mg, 100mg, 250mg, 50mg, 10 mg.
9,9,10,10-tetradeuteriooctadecanoic acid (CAS 130048-57-6) is a chemical compound with the molecular formula C18H36O2 and a molecular weight of 288.5 g/mol. IUPAC name: 9,9,10,10-tetradeuteriooctadecanoic acid. InChIKey: QIQXTHQIDYTFRH-YQUBHJMPSA-N.
| Molecular formula | C18H36O2 |
|---|---|
| Molecular weight | 288.5 g/mol |
| IUPAC name | 9,9,10,10-tetradeuteriooctadecanoic acid |
| InChIKey | QIQXTHQIDYTFRH-YQUBHJMPSA-N |
| SMILES | [2H]C([2H])(CCCCCCCC)C([2H])([2H])CCCCCCCC(=O)O |
Computed by PubChem (NCBI)