CAS 13005-36-2 is the registry number for Potassium phenylacetate. Offered by: Biosynth. Available pack sizes: 0,5g, 1g, 5g.
Potassium 2-phenylacetate (CAS 13005-36-2) is a chemical compound with the molecular formula C8H7KO2 and a molecular weight of 174.24 g/mol. IUPAC name: potassium 2-phenylacetate. InChIKey: JFOZPCWVLIBFCH-UHFFFAOYSA-M.
| Molecular formula | C8H7KO2 |
|---|---|
| Molecular weight | 174.24 g/mol |
| IUPAC name | potassium 2-phenylacetate |
| InChIKey | JFOZPCWVLIBFCH-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)CC(=O)[O-].[K+] |
Computed by PubChem (NCBI)