CAS 1300610-67-6 is the registry number for 2-(Methylthio)-4-((4-phenoxyphenyl)amino)pyrido[4,3-d]pyrimidin-5(6H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-methylsulfanyl-4-(4-phenoxyanilino)-6H-pyrido[4,3-d]pyrimidin-5-one (CAS 1300610-67-6) is a chemical compound with the molecular formula C20H16N4O2S and a molecular weight of 376.4 g/mol. IUPAC name: 2-methylsulfanyl-4-(4-phenoxyanilino)-6H-pyrido[4,3-d]pyrimidin-5-one. InChIKey: HISZEYPBQXPUMB-UHFFFAOYSA-N.
| Molecular formula | C20H16N4O2S |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | 2-methylsulfanyl-4-(4-phenoxyanilino)-6H-pyrido[4,3-d]pyrimidin-5-one |
| InChIKey | HISZEYPBQXPUMB-UHFFFAOYSA-N |
| SMILES | CSC1=NC2=C(C(=O)NC=C2)C(=N1)NC3=CC=C(C=C3)OC4=CC=CC=C4 |
Computed by PubChem (NCBI)