CAS 13007-85-7 appears in our catalog under these names: Glucoheptonic acid sodium salt dihydrate, 98%, Sodium (2R,3R,4S,5R,6R)–2,3,4,5,6,7–hexahydroxyheptanoate, a-D-Glucoheptonic acid sodium salt dihydrate, Sodium (2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate, 97%, 97%, Sodiumα-glucoheptonate,97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5g, 25g, 100g, 1kg, 500g, 2000g, 1000g, 5000g.
Sodium (2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate (CAS 13007-85-7) is a chemical compound with the molecular formula C7H13NaO8 and a molecular weight of 248.16 g/mol. IUPAC name: sodium (2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate. InChIKey: FMYOMWCQJXWGEN-WYRLRVFGSA-M.
| Molecular formula | C7H13NaO8 |
|---|---|
| Molecular weight | 248.16 g/mol |
| IUPAC name | sodium (2R,3R,4S,5R,6R)-2,3,4,5,6,7-hexahydroxyheptanoate |
| InChIKey | FMYOMWCQJXWGEN-WYRLRVFGSA-M |
| SMILES | C([C@H]([C@H]([C@@H]([C@H]([C@H](C(=O)[O-])O)O)O)O)O)O.[Na+] |
Computed by PubChem (NCBI)