CAS 13007-95-9 appears in our catalog under these names: Magnesium porphyrin, 95%, Mg(II) Porphine, Magnesium Porphyrin. Offered by: Combi-blocks, TRC, GLPBio. Available pack sizes: 100mg, 250mg.
CAS 13007-95-9 identifies a chemical compound with the molecular formula C20H14MgN4 and a molecular weight of 334.7 g/mol. InChIKey: BKAFGIQLHHTYKR-UHFFFAOYSA-N.
| Molecular formula | C20H14MgN4 |
|---|---|
| Molecular weight | 334.7 g/mol |
| InChIKey | BKAFGIQLHHTYKR-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC3=CC=C(N3)C=C4C=CC(=N4)C=C5C=CC(=N5)C=C1N2.[Mg] |
Computed by PubChem (NCBI)