CAS 1301214-47-0 appears in our catalog under these names: PF-05175157, PF-05175157/ 99.78% (existing batch purity), PF–05175157, PF 05175157, PF-05175157 99%. Offered by: Chemat Brand, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: on request, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 0,5g.
1'-(2-methyl-3H-benzimidazole-5-carbonyl)-1-propan-2-ylspiro[4,6-dihydroindazole-5,4'-piperidine]-7-one (CAS 1301214-47-0) is a chemical compound with the molecular formula C23H27N5O2 and a molecular weight of 405.5 g/mol. IUPAC name: 1'-(2-methyl-3H-benzimidazole-5-carbonyl)-1-propan-2-ylspiro[4,6-dihydroindazole-5,4'-piperidine]-7-one. InChIKey: BDXXSFOJPYSYOC-UHFFFAOYSA-N.
| Molecular formula | C23H27N5O2 |
|---|---|
| Molecular weight | 405.5 g/mol |
| IUPAC name | 1'-(2-methyl-3H-benzimidazole-5-carbonyl)-1-propan-2-ylspiro[4,6-dihydroindazole-5,4'-piperidine]-7-one |
| InChIKey | BDXXSFOJPYSYOC-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1)C=C(C=C2)C(=O)N3CCC4(CC3)CC5=C(C(=O)C4)N(N=C5)C(C)C |
Computed by PubChem (NCBI)