Products 1301214-80-1
CAS 1301214-80-1 is the registry number for tert-Butyl 1-isopropyl-1,4-dihydrospiro[indazole-5,4'-piperidine]-1'-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 1-propan-2-ylspiro[4H-indazole-5,4'-piperidine]-1'-carboxylate (CAS 1301214-80-1) is a chemical compound with the molecular formula C19H29N3O2 and a molecular weight of 331.5 g/mol. IUPAC name: tert-butyl 1-propan-2-ylspiro[4H-indazole-5,4'-piperidine]-1'-carboxylate. InChIKey: BHEGYIASVKXQPS-UHFFFAOYSA-N.
| Molecular formula | C19H29N3O2 |
|---|---|
| Molecular weight | 331.5 g/mol |
| IUPAC name | tert-butyl 1-propan-2-ylspiro[4H-indazole-5,4'-piperidine]-1'-carboxylate |
| InChIKey | BHEGYIASVKXQPS-UHFFFAOYSA-N |
| SMILES | CC(C)N1C2=C(CC3(CCN(CC3)C(=O)OC(C)(C)C)C=C2)C=N1 |
Computed by PubChem (NCBI)