CAS 1301706-36-4 appears in our catalog under these names: Boc-l-lys(ns)-oh, 98%, Boc-L-Lys(Ns)-OH. Offered by: Combi-blocks, Iris Biotech. Available pack sizes: 5g, 1g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[(2-nitrophenyl)sulfonylamino]hexanoic acid (CAS 1301706-36-4) is a chemical compound with the molecular formula C17H25N3O8S and a molecular weight of 431.5 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[(2-nitrophenyl)sulfonylamino]hexanoic acid. InChIKey: VHWIGZMAQNMNOK-LBPRGKRZSA-N.
| Molecular formula | C17H25N3O8S |
|---|---|
| Molecular weight | 431.5 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-[(2-nitrophenyl)sulfonylamino]hexanoic acid |
| InChIKey | VHWIGZMAQNMNOK-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCNS(=O)(=O)C1=CC=CC=C1[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)