Products 1301706-56-8
CAS 1301706-56-8 is the registry number for (S)-(-)-2-(Boc-aminomethyl)-4,4-diethoxypiperidine fumarate, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 500mg.
(E)-but-2-enedioic acid;tert-butyl N-[[(2S)-4,4-diethoxypiperidin-2-yl]methyl]carbamate (CAS 1301706-56-8) is a chemical compound with the molecular formula C19H34N2O8 and a molecular weight of 418.5 g/mol. IUPAC name: (E)-but-2-enedioic acid;tert-butyl N-[[(2S)-4,4-diethoxypiperidin-2-yl]methyl]carbamate. InChIKey: HCNKZGJFFYKTGU-GYDOPSIJSA-N.
| Molecular formula | C19H34N2O8 |
|---|---|
| Molecular weight | 418.5 g/mol |
| IUPAC name | (E)-but-2-enedioic acid;tert-butyl N-[[(2S)-4,4-diethoxypiperidin-2-yl]methyl]carbamate |
| InChIKey | HCNKZGJFFYKTGU-GYDOPSIJSA-N |
| SMILES | CCOC1(CCN[C@@H](C1)CNC(=O)OC(C)(C)C)OCC.C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)