CAS 1301706-83-1 appears in our catalog under these names: X-Alpha-d-xyl, 95%, 5-Bromo-4-chloro-3-indolyl a-D-xylopyranoside, 5-Bromo-4-chloro-3-indolyl a-D-xylopyran, oside, 5 mg, 5-Bromo-4-chloro-3-indolyl a-D-xylopyran, oside, 10 mg, 5-Bromo-4-chloro-3-indolyl a-D-xylopyran, oside, 25 mg. Offered by: Combi-blocks, Biosynth, Roth. Available pack sizes: 1g, 25g, 10g, 5g, 10mg, 5mg, 25mg, 50mg.
(2R,3R,4S,5R)-2-[(5-bromo-4-chloro-1H-indol-3-yl)oxy]oxane-3,4,5-triol (CAS 1301706-83-1) is a chemical compound with the molecular formula C13H13BrClNO5 and a molecular weight of 378.60 g/mol. IUPAC name: (2R,3R,4S,5R)-2-[(5-bromo-4-chloro-1H-indol-3-yl)oxy]oxane-3,4,5-triol. InChIKey: LXVCKAHHHVVOJV-SZOBPAOMSA-N.
| Molecular formula | C13H13BrClNO5 |
|---|---|
| Molecular weight | 378.60 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-[(5-bromo-4-chloro-1H-indol-3-yl)oxy]oxane-3,4,5-triol |
| InChIKey | LXVCKAHHHVVOJV-SZOBPAOMSA-N |
| SMILES | C1[C@H]([C@@H]([C@H]([C@H](O1)OC2=CNC3=C2C(=C(C=C3)Br)Cl)O)O)O |
Computed by PubChem (NCBI)