Products 1301738-60-2

CAS 1301738-60-2 is the registry number for 1-[(5-Bromothien-2-yl)sulphonyl]pyrrolidine-2-carboxylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 10g, 5g.

Structural formula: {0} (CAS {1})

1-(5-bromothiophen-2-yl)sulfonylpyrrolidine-2-carboxylic acid (CAS 1301738-60-2) is a chemical compound with the molecular formula C9H10BrNO4S2 and a molecular weight of 340.2 g/mol. IUPAC name: 1-(5-bromothiophen-2-yl)sulfonylpyrrolidine-2-carboxylic acid. InChIKey: BPZROJBFWUPMAB-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10BrNO4S2
Molecular weight340.2 g/mol
IUPAC name1-(5-bromothiophen-2-yl)sulfonylpyrrolidine-2-carboxylic acid
InChIKeyBPZROJBFWUPMAB-UHFFFAOYSA-N
SMILESC1CC(N(C1)S(=O)(=O)C2=CC=C(S2)Br)C(=O)O

Computed by PubChem (NCBI)