Products 1301738-97-5
CAS 1301738-97-5 is the registry number for (9H-Fluoren-9-yl)methyl (4-carbamothioylphenyl)carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
9H-fluoren-9-ylmethyl N-(4-carbamothioylphenyl)carbamate (CAS 1301738-97-5) is a chemical compound with the molecular formula C22H18N2O2S and a molecular weight of 374.5 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(4-carbamothioylphenyl)carbamate. InChIKey: DVROTYWWQWLSON-UHFFFAOYSA-N.
| Molecular formula | C22H18N2O2S |
|---|---|
| Molecular weight | 374.5 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-(4-carbamothioylphenyl)carbamate |
| InChIKey | DVROTYWWQWLSON-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=CC=C(C=C4)C(=S)N |
Computed by PubChem (NCBI)