Products 130195-74-3
CAS 130195-74-3 is the registry number for methyl (1S,4R,6R)-5-[(1S)-1-phenylethyl]-5-azabicyclo[2.2.1]hept-2-ene-6-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 25g.
Methyl (1R,3R,4S)-2-[(1S)-1-phenylethyl]-2-azabicyclo[2.2.1]hept-5-ene-3-carboxylate (CAS 130195-74-3) is a chemical compound with the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. IUPAC name: methyl (1R,3R,4S)-2-[(1S)-1-phenylethyl]-2-azabicyclo[2.2.1]hept-5-ene-3-carboxylate. InChIKey: PWUWUKQPSOGOPL-PMOUVXMZSA-N.
| Molecular formula | C16H19NO2 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | methyl (1R,3R,4S)-2-[(1S)-1-phenylethyl]-2-azabicyclo[2.2.1]hept-5-ene-3-carboxylate |
| InChIKey | PWUWUKQPSOGOPL-PMOUVXMZSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)N2[C@@H]3C[C@H]([C@@H]2C(=O)OC)C=C3 |
Computed by PubChem (NCBI)