CAS 923821-08-3 is the registry number for 1-(4-Isopropylphenyl)-2,5-dimethyl-1h-pyrrole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
2,5-dimethyl-1-(4-propan-2-ylphenyl)pyrrole-3-carboxylic acid (CAS 923821-08-3) is a chemical compound with the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. IUPAC name: 2,5-dimethyl-1-(4-propan-2-ylphenyl)pyrrole-3-carboxylic acid. InChIKey: KBDRSEIACOQQCX-UHFFFAOYSA-N.
| Molecular formula | C16H19NO2 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | 2,5-dimethyl-1-(4-propan-2-ylphenyl)pyrrole-3-carboxylic acid |
| InChIKey | KBDRSEIACOQQCX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=CC=C(C=C2)C(C)C)C)C(=O)O |
Computed by PubChem (NCBI)