CAS 130209-90-4 appears in our catalog under these names: (±)-Clopidogrel hydrochloride, 98%, (±)-Clopidogrel (hydrochloride), (±)–Clopidogrel (hydrochloride), (±)-Clopidogrel hydrochloride, (±)-Clopidogrel HCl 98%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 10mg, 50mg, 1g, 5g, 25g, 10mM/1mL, 50 mg.
Methyl 2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate;hydrochloride (CAS 130209-90-4) is a chemical compound with the molecular formula C16H17Cl2NO2S and a molecular weight of 358.3 g/mol. IUPAC name: methyl 2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate;hydrochloride. InChIKey: XIHVAFJSGWDBGA-UHFFFAOYSA-N.
| Molecular formula | C16H17Cl2NO2S |
|---|---|
| Molecular weight | 358.3 g/mol |
| IUPAC name | methyl 2-(2-chlorophenyl)-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)acetate;hydrochloride |
| InChIKey | XIHVAFJSGWDBGA-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=CC=CC=C1Cl)N2CCC3=C(C2)C=CS3.Cl |
Computed by PubChem (NCBI)