CAS 13021-40-4 appears in our catalog under these names: Potassium rhodizonate, 95%, Potassium 3,4,5,6-tetraoxocyclohex-1-ene-1,2-bis(olate), 98%, Potassium Rhodizonate, Rhodizonic acid, dipotassium salt, Potassium Rhodizonate, >95.0%(T). Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, TCI. Available pack sizes: 250mg, 1g, 25g, 5g, 10g, 50g, 100g, 100mg.
Dipotassium;3,4,5,6-tetraoxocyclohexene-1,2-diolate (CAS 13021-40-4) is a chemical compound with the molecular formula C6K2O6 and a molecular weight of 246.26 g/mol. IUPAC name: dipotassium;3,4,5,6-tetraoxocyclohexene-1,2-diolate. InChIKey: NEWIILAQDSMNML-UHFFFAOYSA-L.
| Molecular formula | C6K2O6 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | dipotassium;3,4,5,6-tetraoxocyclohexene-1,2-diolate |
| InChIKey | NEWIILAQDSMNML-UHFFFAOYSA-L |
| SMILES | C1(=C(C(=O)C(=O)C(=O)C1=O)[O-])[O-].[K+].[K+] |
Computed by PubChem (NCBI)