CAS 130232-51-8 appears in our catalog under these names: Ciprofibrate EP Impurity D, Ciprofibrate Impurity 4(Ciprofibrate EP Impurity D), Ciprofibrate Methyl Ester, >95% (HPLC), Ciprofibrate methyl ester, Ciprofibrate Methyl Ester, 95%, 95%. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth, Chemat. Available pack sizes: on request, 100mg, 10mg, 200mg, 25mg, 50mg, 1g, 250mg.
Methyl 2-[4-(2,2-dichlorocyclopropyl)phenoxy]-2-methylpropanoate (CAS 130232-51-8) is a chemical compound with the molecular formula C14H16Cl2O3 and a molecular weight of 303.2 g/mol. IUPAC name: methyl 2-[4-(2,2-dichlorocyclopropyl)phenoxy]-2-methylpropanoate. InChIKey: QKMIJFOKKANKAZ-UHFFFAOYSA-N.
| Molecular formula | C14H16Cl2O3 |
|---|---|
| Molecular weight | 303.2 g/mol |
| IUPAC name | methyl 2-[4-(2,2-dichlorocyclopropyl)phenoxy]-2-methylpropanoate |
| InChIKey | QKMIJFOKKANKAZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)OC)OC1=CC=C(C=C1)C2CC2(Cl)Cl |
Computed by PubChem (NCBI)