Products 130318-01-3

CAS 130318-01-3 is the registry number for 2,3,4-Triphenylpyridine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.

Structural formula: {0} (CAS {1})

2,3,4-triphenylpyridine (CAS 130318-01-3) is a chemical compound with the molecular formula C23H17N and a molecular weight of 307.4 g/mol. IUPAC name: 2,3,4-triphenylpyridine. InChIKey: SGPZQRDTKWINJJ-UHFFFAOYSA-N.

Identity
Molecular formulaC23H17N
Molecular weight307.4 g/mol
IUPAC name2,3,4-triphenylpyridine
InChIKeySGPZQRDTKWINJJ-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=C(C(=NC=C2)C3=CC=CC=C3)C4=CC=CC=C4

Computed by PubChem (NCBI)

Synonyms: triphenylpyridine