CAS 130323-36-3 is the registry number for 3,6-Di-O-benzoyl-D-galactal. Offered by: Biosynth, Chemat. Available pack sizes: 500mg, 100mg, 1g, 250mg.
[(2R,3R,4R)-4-benzoyloxy-3-hydroxy-3,4-dihydro-2H-pyran-2-yl]methyl benzoate (CAS 130323-36-3) is a chemical compound with the molecular formula C20H18O6 and a molecular weight of 354.4 g/mol. IUPAC name: [(2R,3R,4R)-4-benzoyloxy-3-hydroxy-3,4-dihydro-2H-pyran-2-yl]methyl benzoate. InChIKey: MXJFEWOUOTWSTM-KZNAEPCWSA-N.
| Molecular formula | C20H18O6 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | [(2R,3R,4R)-4-benzoyloxy-3-hydroxy-3,4-dihydro-2H-pyran-2-yl]methyl benzoate |
| InChIKey | MXJFEWOUOTWSTM-KZNAEPCWSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC[C@@H]2[C@@H]([C@@H](C=CO2)OC(=O)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)