CAS 1303470-48-5 appears in our catalog under these names: KHK–IN–1 hydrochloride (ketohexokinase inhibitor), Khk-in-1 hydrochloride, 95%, KHK-IN-1 hydrochloride, KHK-IN-1 HCl 98%, KHK-IN-1 (hydrochloride), 98.47%. Offered by: GLPBio, Combi-blocks, TargetMol, Ambeed, MedChemExpress. Available pack sizes: 5mg, 10mg, 50mg, 25mg, 100mg, 10mM (in 1ml dmso), 1mg, 5 mg.
8-N-(cyclopropylmethyl)-4-N-(2-methylsulfanylphenyl)-2-piperazin-1-ylpyrimido[5,4-d]pyrimidine-4,8-diamine;hydrochloride (CAS 1303470-48-5) is a chemical compound with the molecular formula C21H27ClN8S and a molecular weight of 459.0 g/mol. IUPAC name: 8-N-(cyclopropylmethyl)-4-N-(2-methylsulfanylphenyl)-2-piperazin-1-ylpyrimido[5,4-d]pyrimidine-4,8-diamine;hydrochloride. InChIKey: VKIBPWKARAEIHN-UHFFFAOYSA-N.
| Molecular formula | C21H27ClN8S |
|---|---|
| Molecular weight | 459.0 g/mol |
| IUPAC name | 8-N-(cyclopropylmethyl)-4-N-(2-methylsulfanylphenyl)-2-piperazin-1-ylpyrimido[5,4-d]pyrimidine-4,8-diamine;hydrochloride |
| InChIKey | VKIBPWKARAEIHN-UHFFFAOYSA-N |
| SMILES | CSC1=CC=CC=C1NC2=NC(=NC3=C2N=CN=C3NCC4CC4)N5CCNCC5.Cl |
Computed by PubChem (NCBI)