CAS 1303490-08-5 is the registry number for 3-((2-Bromo-4-fluorobenzyl)(methyl)amino)tetrahydrothiophene 1,1-dioxide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(2-bromo-4-fluorophenyl)methyl]-N-methyl-1,1-dioxothiolan-3-amine (CAS 1303490-08-5) is a chemical compound with the molecular formula C12H15BrFNO2S and a molecular weight of 336.22 g/mol. IUPAC name: N-[(2-bromo-4-fluorophenyl)methyl]-N-methyl-1,1-dioxothiolan-3-amine. InChIKey: PRWNOBVSWFEGIT-UHFFFAOYSA-N.
| Molecular formula | C12H15BrFNO2S |
|---|---|
| Molecular weight | 336.22 g/mol |
| IUPAC name | N-[(2-bromo-4-fluorophenyl)methyl]-N-methyl-1,1-dioxothiolan-3-amine |
| InChIKey | PRWNOBVSWFEGIT-UHFFFAOYSA-N |
| SMILES | CN(CC1=C(C=C(C=C1)F)Br)C2CCS(=O)(=O)C2 |
Computed by PubChem (NCBI)