CAS 1303525-72-5 is the registry number for Potassium 2-methyl-3,5-dinitrobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Potassium 2-methyl-3,5-dinitrobenzoate (CAS 1303525-72-5) is a chemical compound with the molecular formula C8H5KN2O6 and a molecular weight of 264.23 g/mol. IUPAC name: potassium 2-methyl-3,5-dinitrobenzoate. InChIKey: IYBGJORRYZMVLX-UHFFFAOYSA-M.
| Molecular formula | C8H5KN2O6 |
|---|---|
| Molecular weight | 264.23 g/mol |
| IUPAC name | potassium 2-methyl-3,5-dinitrobenzoate |
| InChIKey | IYBGJORRYZMVLX-UHFFFAOYSA-M |
| SMILES | CC1=C(C=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C(=O)[O-].[K+] |
Computed by PubChem (NCBI)