CAS 13037-79-1 is the registry number for Metacresol Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.
2-tert-butyl-3-methylphenol (CAS 13037-79-1) is a chemical compound with the molecular formula C11H16O and a molecular weight of 164.24 g/mol. IUPAC name: 2-tert-butyl-3-methylphenol. InChIKey: SDJUKATYFRSDAS-UHFFFAOYSA-N.
| Molecular formula | C11H16O |
|---|---|
| Molecular weight | 164.24 g/mol |
| IUPAC name | 2-tert-butyl-3-methylphenol |
| InChIKey | SDJUKATYFRSDAS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)O)C(C)(C)C |
Computed by PubChem (NCBI)