Products 1303967-24-9
CAS 1303967-24-9 is the registry number for 4–Bromo–3，5–(dimethyl–d6)–pyrazole. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
4-bromo-3,5-bis(trideuteriomethyl)-1H-pyrazole (CAS 1303967-24-9) is a chemical compound with the molecular formula C5H7BrN2 and a molecular weight of 181.06 g/mol. IUPAC name: 4-bromo-3,5-bis(trideuteriomethyl)-1H-pyrazole. InChIKey: RISOHYOEPYWKOB-WFGJKAKNSA-N.
| Molecular formula | C5H7BrN2 |
|---|---|
| Molecular weight | 181.06 g/mol |
| IUPAC name | 4-bromo-3,5-bis(trideuteriomethyl)-1H-pyrazole |
| InChIKey | RISOHYOEPYWKOB-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C1=C(C(=NN1)C([2H])([2H])[2H])Br |
Computed by PubChem (NCBI)