CAS 1303993-73-8 appears in our catalog under these names: CHPG sodium salt/ 100%, CHPG Sodium salt, CHPG (sodium salt), CHPG (sodium salt), 99.25%, CHPG (sodium salt) (Standard). Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 100mg, 25mg, 50mg, 1mg, 10mM/1mL, 100 mg.
Sodium 2-amino-2-(2-chloro-5-hydroxyphenyl)acetate (CAS 1303993-73-8) is a chemical compound with the molecular formula C8H7ClNNaO3 and a molecular weight of 223.59 g/mol. IUPAC name: sodium 2-amino-2-(2-chloro-5-hydroxyphenyl)acetate. InChIKey: KZRZZIISUUINJT-UHFFFAOYSA-M.
| Molecular formula | C8H7ClNNaO3 |
|---|---|
| Molecular weight | 223.59 g/mol |
| IUPAC name | sodium 2-amino-2-(2-chloro-5-hydroxyphenyl)acetate |
| InChIKey | KZRZZIISUUINJT-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C=C1O)C(C(=O)[O-])N)Cl.[Na+] |
Computed by PubChem (NCBI)