CAS 1303994-09-3 appears in our catalog under these names: (RS)–MCPG disodium salt, MCPG (sodium). Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 50mg, Get quote.
Disodium;4-(1-amino-1-carboxylatoethyl)benzoate (CAS 1303994-09-3) is a chemical compound with the molecular formula C10H9NNa2O4 and a molecular weight of 253.16 g/mol. IUPAC name: disodium;4-(1-amino-1-carboxylatoethyl)benzoate. InChIKey: YGOTXTUQJLFNHB-UHFFFAOYSA-L.
| Molecular formula | C10H9NNa2O4 |
|---|---|
| Molecular weight | 253.16 g/mol |
| IUPAC name | disodium;4-(1-amino-1-carboxylatoethyl)benzoate |
| InChIKey | YGOTXTUQJLFNHB-UHFFFAOYSA-L |
| SMILES | CC(C1=CC=C(C=C1)C(=O)[O-])(C(=O)[O-])N.[Na+].[Na+] |
Computed by PubChem (NCBI)