CAS 130416-51-2 appears in our catalog under these names: 2–(3,5–Difluorophenyl)propan–2–amine, 2-(3,5-Difluorophenyl)propan-2-amine, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
2-(3,5-difluorophenyl)propan-2-amine (CAS 130416-51-2) is a chemical compound with the molecular formula C9H11F2N and a molecular weight of 171.19 g/mol. IUPAC name: 2-(3,5-difluorophenyl)propan-2-amine. InChIKey: OPFPWVYVDSZPFB-UHFFFAOYSA-N.
| Molecular formula | C9H11F2N |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | 2-(3,5-difluorophenyl)propan-2-amine |
| InChIKey | OPFPWVYVDSZPFB-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=CC(=C1)F)F)N |
Computed by PubChem (NCBI)