Products 130442-98-7

CAS 130442-98-7 is the registry number for Ethyl 2-Cyanoacetate-13C 15N. Offered by: TRC. Available pack sizes: 500mg.

Structural formula: {0} (CAS {1})

Ethyl 2-((15N)azanylidyne(113C)methyl)acetate (CAS 130442-98-7) is a chemical compound with the molecular formula C5H7NO2 and a molecular weight of 115.10 g/mol. IUPAC name: ethyl 2-((15N)azanylidyne(113C)methyl)acetate. InChIKey: ZIUSEGSNTOUIPT-UHJUODCXSA-N.

Identity
Molecular formulaC5H7NO2
Molecular weight115.10 g/mol
IUPAC nameethyl 2-((15N)azanylidyne(113C)methyl)acetate
InChIKeyZIUSEGSNTOUIPT-UHJUODCXSA-N
SMILESCCOC(=O)C[13C]#[15N]

Computed by PubChem (NCBI)