Products 1304453-30-2

CAS 1304453-30-2 is the registry number for 4-(4-Fluoro-2-nitrophenoxy)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-(4-fluoro-2-nitrophenoxy)benzoic acid (CAS 1304453-30-2) is a chemical compound with the molecular formula C13H8FNO5 and a molecular weight of 277.20 g/mol. IUPAC name: 4-(4-fluoro-2-nitrophenoxy)benzoic acid. InChIKey: CGCOHDGCNCKNQP-UHFFFAOYSA-N.

Identity
Molecular formulaC13H8FNO5
Molecular weight277.20 g/mol
IUPAC name4-(4-fluoro-2-nitrophenoxy)benzoic acid
InChIKeyCGCOHDGCNCKNQP-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(=O)O)OC2=C(C=C(C=C2)F)[N+](=O)[O-]

Computed by PubChem (NCBI)