Products 1304860-73-8

CAS 1304860-73-8 is the registry number for 4-([(Cyclopropylmethyl)(propan-2-yl)amino]methyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

4-[[cyclopropylmethyl(propan-2-yl)amino]methyl]benzoic acid (CAS 1304860-73-8) is a chemical compound with the molecular formula C15H21NO2 and a molecular weight of 247.33 g/mol. IUPAC name: 4-[[cyclopropylmethyl(propan-2-yl)amino]methyl]benzoic acid. InChIKey: IWKFDCWCXGGJEU-UHFFFAOYSA-N.

Identity
Molecular formulaC15H21NO2
Molecular weight247.33 g/mol
IUPAC name4-[[cyclopropylmethyl(propan-2-yl)amino]methyl]benzoic acid
InChIKeyIWKFDCWCXGGJEU-UHFFFAOYSA-N
SMILESCC(C)N(CC1CC1)CC2=CC=C(C=C2)C(=O)O

Computed by PubChem (NCBI)