CAS 130506-36-4 is the registry number for Methyl-(allyl 2,3,4-tetra-o-acetyl-beta-d-galactopyranosid)uronate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
Methyl (2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-prop-2-enoxyoxane-2-carboxylate (CAS 130506-36-4) is a chemical compound with the molecular formula C16H22O10 and a molecular weight of 374.34 g/mol. IUPAC name: methyl (2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-prop-2-enoxyoxane-2-carboxylate. InChIKey: ZMKKPVNDESHQBT-WZYWGQKZSA-N.
| Molecular formula | C16H22O10 |
|---|---|
| Molecular weight | 374.34 g/mol |
| IUPAC name | methyl (2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-prop-2-enoxyoxane-2-carboxylate |
| InChIKey | ZMKKPVNDESHQBT-WZYWGQKZSA-N |
| SMILES | CC(=O)O[C@H]1[C@H]([C@H](O[C@H]([C@@H]1OC(=O)C)OCC=C)C(=O)OC)OC(=O)C |
Computed by PubChem (NCBI)