Products 13052-95-4
CAS 13052-95-4 is the registry number for 3′-Deoxyadenosine 5′-diphosphate. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate (CAS 13052-95-4) is a chemical compound with the molecular formula C10H15N5O9P2 and a molecular weight of 411.20 g/mol. IUPAC name: [(2S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate. InChIKey: OBEBFUHFXYDSAW-BAJZRUMYSA-N.
| Molecular formula | C10H15N5O9P2 |
|---|---|
| Molecular weight | 411.20 g/mol |
| IUPAC name | [(2S,4R,5R)-5-(6-aminopurin-9-yl)-4-hydroxyoxolan-2-yl]methyl phosphono hydrogen phosphate |
| InChIKey | OBEBFUHFXYDSAW-BAJZRUMYSA-N |
| SMILES | C1[C@H](O[C@H]([C@@H]1O)N2C=NC3=C(N=CN=C32)N)COP(=O)(O)OP(=O)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3'-Deoxyadenosine 5'-(trihydrogen diphosphate), 3'-deoxyadenosine 5'-diphosphate, Cordycepin, diphosphate, 3'-dADP, Adenosine 5'-(trihydrogen diphosphate), 3'-deoxy-, 3a(2)-Deoxyadenosine 5a(2)-(trihydrogen diphosphate), Adenosine, 3'-deoxy-, 5'-(trihydrogen pyrophosphate), 3'-Deoxyadenosine 5'-DiphosphateDiscontinued, see D232038, CUU