CAS 130525-41-6 appears in our catalog under these names: 2,7-Di-tert-butyl-9,9-dimethyl-9H-xanthene, 97%, 2,7-DI-TERT-BUTYL-9,9-DIMETHYLXANTHENE,&, 2,7-di-tert-butyl-9,9-dimethyl-9H-xanthene, 97%, 97%, 9H-Xanthene, 2,7-bis(1,1-dimethylethyl)-9,9-dimethyl-, 99%(GC-MS),RG. Offered by: AmBeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 100mg, 250mg, 500mg, 1g.
2,7-ditert-butyl-9,9-dimethylxanthene (CAS 130525-41-6) is a chemical compound with the molecular formula C23H30O and a molecular weight of 322.5 g/mol. IUPAC name: 2,7-ditert-butyl-9,9-dimethylxanthene. InChIKey: COCYABCDIOEUAC-UHFFFAOYSA-N.
| Molecular formula | C23H30O |
|---|---|
| Molecular weight | 322.5 g/mol |
| IUPAC name | 2,7-ditert-butyl-9,9-dimethylxanthene |
| InChIKey | COCYABCDIOEUAC-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)C(C)(C)C)OC3=C1C=C(C=C3)C(C)(C)C)C |
Computed by PubChem (NCBI)