CAS 130525-62-1 appears in our catalog under these names: Zanamivir EP Impurity C, Zanamivir Amine, >95% (HPLC), Zanamivir amine. Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 1mg, 5mg, 0,5mg, 2mg, 10mg, 1 mg, 5 mg.
(2R,3R,4S)-3-acetamido-4-amino-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid (CAS 130525-62-1) is a chemical compound with the molecular formula C11H18N2O7 and a molecular weight of 290.27 g/mol. IUPAC name: (2R,3R,4S)-3-acetamido-4-amino-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid. InChIKey: NKENBBIXEGPQLS-UFGQHTETSA-N.
| Molecular formula | C11H18N2O7 |
|---|---|
| Molecular weight | 290.27 g/mol |
| IUPAC name | (2R,3R,4S)-3-acetamido-4-amino-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
| InChIKey | NKENBBIXEGPQLS-UFGQHTETSA-N |
| SMILES | CC(=O)N[C@@H]1[C@H](C=C(O[C@H]1[C@@H]([C@@H](CO)O)O)C(=O)O)N |
Computed by PubChem (NCBI)