CAS 1305322-90-0 is the registry number for 4-Bromo-N-t-butyl-2-nitro-5-propoxyaniline, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-bromo-N-tert-butyl-2-nitro-5-propoxyaniline (CAS 1305322-90-0) is a chemical compound with the molecular formula C13H19BrN2O3 and a molecular weight of 331.21 g/mol. IUPAC name: 4-bromo-N-tert-butyl-2-nitro-5-propoxyaniline. InChIKey: IGJKOHOAQWXYTN-UHFFFAOYSA-N.
| Molecular formula | C13H19BrN2O3 |
|---|---|
| Molecular weight | 331.21 g/mol |
| IUPAC name | 4-bromo-N-tert-butyl-2-nitro-5-propoxyaniline |
| InChIKey | IGJKOHOAQWXYTN-UHFFFAOYSA-N |
| SMILES | CCCOC1=C(C=C(C(=C1)NC(C)(C)C)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)