Products 1305324-95-1
CAS 1305324-95-1 is the registry number for N-(2-Chloro-4-hydroxy-6-iodopyridin-3-yl)pivalamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
N-(2-chloro-6-iodo-4-oxo-1H-pyridin-3-yl)-2,2-dimethylpropanamide (CAS 1305324-95-1) is a chemical compound with the molecular formula C10H12ClIN2O2 and a molecular weight of 354.57 g/mol. IUPAC name: N-(2-chloro-6-iodo-4-oxo-1H-pyridin-3-yl)-2,2-dimethylpropanamide. InChIKey: WNCSGUAFIACQEZ-UHFFFAOYSA-N.
| Molecular formula | C10H12ClIN2O2 |
|---|---|
| Molecular weight | 354.57 g/mol |
| IUPAC name | N-(2-chloro-6-iodo-4-oxo-1H-pyridin-3-yl)-2,2-dimethylpropanamide |
| InChIKey | WNCSGUAFIACQEZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=C(NC(=CC1=O)I)Cl |
Computed by PubChem (NCBI)