CAS 1305325-19-2 is the registry number for tert-Butyl (2-(tert-butyl)oxazolo[4,5-c]pyridin-7-yl)carbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl N-(2-tert-butyl-[1,3]oxazolo[4,5-c]pyridin-7-yl)carbamate (CAS 1305325-19-2) is a chemical compound with the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. IUPAC name: tert-butyl N-(2-tert-butyl-[1,3]oxazolo[4,5-c]pyridin-7-yl)carbamate. InChIKey: RGXQPISGOOBERU-UHFFFAOYSA-N.
| Molecular formula | C15H21N3O3 |
|---|---|
| Molecular weight | 291.35 g/mol |
| IUPAC name | tert-butyl N-(2-tert-butyl-[1,3]oxazolo[4,5-c]pyridin-7-yl)carbamate |
| InChIKey | RGXQPISGOOBERU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC2=CN=CC(=C2O1)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)