CAS 1305711-93-6 appears in our catalog under these names: ((2-Chloro-4-fluorophenyl)(phenyl)methyl)(methyl)amine hydrochloride, 95%, ((2-Chloro-4-fluorophenyl)(phenyl)methyl)(methyl)amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
1-(2-chloro-4-fluorophenyl)-N-methyl-1-phenylmethanamine;hydrochloride (CAS 1305711-93-6) is a chemical compound with the molecular formula C14H14Cl2FN and a molecular weight of 286.2 g/mol. IUPAC name: 1-(2-chloro-4-fluorophenyl)-N-methyl-1-phenylmethanamine;hydrochloride. InChIKey: SUIMGUOSYAWMMH-UHFFFAOYSA-N.
| Molecular formula | C14H14Cl2FN |
|---|---|
| Molecular weight | 286.2 g/mol |
| IUPAC name | 1-(2-chloro-4-fluorophenyl)-N-methyl-1-phenylmethanamine;hydrochloride |
| InChIKey | SUIMGUOSYAWMMH-UHFFFAOYSA-N |
| SMILES | CNC(C1=CC=CC=C1)C2=C(C=C(C=C2)F)Cl.Cl |
Computed by PubChem (NCBI)