Products 130597-31-8
CAS 130597-31-8 appears in our catalog under these names: Fmoc-achpa, 95%, Fmoc-(3S,4S)ACHPA-OH, Fmoc-ACHPA-OH, 98%, (3S,4S)-4-((((9H-Fluoren-9-Yl)Methoxy)Carbonyl)Amino)-5-Cyclohexyl-3-Hydroxypentanoic Acid, 98%. Offered by: Combi-blocks, Iris Biotech, Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 100mg.
(3S,4S)-5-cyclohexyl-4-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxypentanoic acid (CAS 130597-31-8) is a chemical compound with the molecular formula C26H31NO5 and a molecular weight of 437.5 g/mol. IUPAC name: (3S,4S)-5-cyclohexyl-4-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxypentanoic acid. InChIKey: NTQQMWZNOTYXHU-ZEQRLZLVSA-N.
| Molecular formula | C26H31NO5 |
|---|---|
| Molecular weight | 437.5 g/mol |
| IUPAC name | (3S,4S)-5-cyclohexyl-4-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxypentanoic acid |
| InChIKey | NTQQMWZNOTYXHU-ZEQRLZLVSA-N |
| SMILES | C1CCC(CC1)C[C@@H]([C@H](CC(=O)O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)