CAS 1306024-95-2 appears in our catalog under these names: 4-(4-Cyano-2-methylphenoxy)benzoic acid, 4-(4-Cyano-2-methylphenoxy)benzoic acid, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 5g, 10g, 250mg.
4-(4-cyano-2-methylphenoxy)benzoic acid (CAS 1306024-95-2) is a chemical compound with the molecular formula C15H11NO3 and a molecular weight of 253.25 g/mol. IUPAC name: 4-(4-cyano-2-methylphenoxy)benzoic acid. InChIKey: AVGZNBHMWZPESM-UHFFFAOYSA-N.
| Molecular formula | C15H11NO3 |
|---|---|
| Molecular weight | 253.25 g/mol |
| IUPAC name | 4-(4-cyano-2-methylphenoxy)benzoic acid |
| InChIKey | AVGZNBHMWZPESM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C#N)OC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)