CAS 13064-50-1 is the registry number for Chloroacetaldehyde Sodium Bisulfite. Offered by: TRC. Available pack sizes: 2,5g, 250mg, 500mg.
Sodium 2-chloro-1-hydroxyethanesulfonate (CAS 13064-50-1) is a chemical compound with the molecular formula C2H4ClNaO4S and a molecular weight of 182.56 g/mol. IUPAC name: sodium 2-chloro-1-hydroxyethanesulfonate. InChIKey: FOSIEWVVVRVFJH-UHFFFAOYSA-M.
| Molecular formula | C2H4ClNaO4S |
|---|---|
| Molecular weight | 182.56 g/mol |
| IUPAC name | sodium 2-chloro-1-hydroxyethanesulfonate |
| InChIKey | FOSIEWVVVRVFJH-UHFFFAOYSA-M |
| SMILES | C(C(O)S(=O)(=O)[O-])Cl.[Na+] |
Computed by PubChem (NCBI)