CAS 1306540-15-7 is the registry number for 6-((3-Bromobenzyl)oxy)-3,4-dihydronaphthalen-1(2H)-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
6-[(3-bromophenyl)methoxy]-3,4-dihydro-2H-naphthalen-1-one (CAS 1306540-15-7) is a chemical compound with the molecular formula C17H15BrO2 and a molecular weight of 331.2 g/mol. IUPAC name: 6-[(3-bromophenyl)methoxy]-3,4-dihydro-2H-naphthalen-1-one. InChIKey: XEWIJBLUIQWBRA-UHFFFAOYSA-N.
| Molecular formula | C17H15BrO2 |
|---|---|
| Molecular weight | 331.2 g/mol |
| IUPAC name | 6-[(3-bromophenyl)methoxy]-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | XEWIJBLUIQWBRA-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)OCC3=CC(=CC=C3)Br)C(=O)C1 |
Computed by PubChem (NCBI)