CAS 1306605-05-9 appears in our catalog under these names: 4-([6-(Trifluoromethyl)pyridin-2-yl]oxy)aniline hydrochloride, 95%, 4-{(6-(Trifluoromethyl)pyridin-2-yl)oxy}aniline hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
4-[[6-(trifluoromethyl)-2-pyridinyl]oxy]aniline;hydrochloride (CAS 1306605-05-9) is a chemical compound with the molecular formula C12H10ClF3N2O and a molecular weight of 290.67 g/mol. IUPAC name: 4-[[6-(trifluoromethyl)-2-pyridinyl]oxy]aniline;hydrochloride. InChIKey: FGQHUCAYORZCND-UHFFFAOYSA-N.
| Molecular formula | C12H10ClF3N2O |
|---|---|
| Molecular weight | 290.67 g/mol |
| IUPAC name | 4-[[6-(trifluoromethyl)-2-pyridinyl]oxy]aniline;hydrochloride |
| InChIKey | FGQHUCAYORZCND-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)OC2=CC=C(C=C2)N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)