CAS 1306605-36-6 is the registry number for 6-(Aminomethyl)-5,7-dimethyl-1H,2H-pyrazolo(1,5-a)pyrimidin-2-one dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-(aminomethyl)-5,7-dimethyl-1H-pyrazolo[1,5-a]pyrimidin-2-one;dihydrochloride (CAS 1306605-36-6) is a chemical compound with the molecular formula C9H14Cl2N4O and a molecular weight of 265.14 g/mol. IUPAC name: 6-(aminomethyl)-5,7-dimethyl-1H-pyrazolo[1,5-a]pyrimidin-2-one;dihydrochloride. InChIKey: STFRZOJOMLDLRW-UHFFFAOYSA-N.
| Molecular formula | C9H14Cl2N4O |
|---|---|
| Molecular weight | 265.14 g/mol |
| IUPAC name | 6-(aminomethyl)-5,7-dimethyl-1H-pyrazolo[1,5-a]pyrimidin-2-one;dihydrochloride |
| InChIKey | STFRZOJOMLDLRW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC2=CC(=O)NN12)C)CN.Cl.Cl |
Computed by PubChem (NCBI)