CAS 1306738-30-6 is the registry number for 2-[1-(Chloroacetyl)-3-oxopiperazin-2-yl]-n-(4-phenoxyphenyl)acetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-[1-(2-chloroacetyl)-3-oxopiperazin-2-yl]-N-(4-phenoxyphenyl)acetamide (CAS 1306738-30-6) is a chemical compound with the molecular formula C20H20ClN3O4 and a molecular weight of 401.8 g/mol. IUPAC name: 2-[1-(2-chloroacetyl)-3-oxopiperazin-2-yl]-N-(4-phenoxyphenyl)acetamide. InChIKey: YBDHLYOJLCJEKL-UHFFFAOYSA-N.
| Molecular formula | C20H20ClN3O4 |
|---|---|
| Molecular weight | 401.8 g/mol |
| IUPAC name | 2-[1-(2-chloroacetyl)-3-oxopiperazin-2-yl]-N-(4-phenoxyphenyl)acetamide |
| InChIKey | YBDHLYOJLCJEKL-UHFFFAOYSA-N |
| SMILES | C1CN(C(C(=O)N1)CC(=O)NC2=CC=C(C=C2)OC3=CC=CC=C3)C(=O)CCl |
Computed by PubChem (NCBI)