CAS 1306739-82-1 is the registry number for N-(4-Ethylphenyl)-n'-(6-methyl-4-oxo-1,4-dihydropyrimidin-2-yl)guanidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(4-ethylphenyl)-2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)guanidine (CAS 1306739-82-1) is a chemical compound with the molecular formula C14H17N5O and a molecular weight of 271.32 g/mol. IUPAC name: 1-(4-ethylphenyl)-2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)guanidine. InChIKey: LOZPHVODHQRACU-UHFFFAOYSA-N.
| Molecular formula | C14H17N5O |
|---|---|
| Molecular weight | 271.32 g/mol |
| IUPAC name | 1-(4-ethylphenyl)-2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)guanidine |
| InChIKey | LOZPHVODHQRACU-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)NC(=NC2=NC(=CC(=O)N2)C)N |
Computed by PubChem (NCBI)